EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | C#C[C@@H](O)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H7NO3/c1-2-3(7)4(6)5(8)9/h1,3-4,7H,6H2,(H,8,9)/t3-,4+/m1/s1 |
| InChIKey | RBWXRFBKVDBXEG-DMTCNVIQSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-β-ethynylserine zwitterion (CHEBI:144729) has role antibacterial agent (CHEBI:33282) |
| L-β-ethynylserine zwitterion (CHEBI:144729) has role antimetabolite (CHEBI:35221) |
| L-β-ethynylserine zwitterion (CHEBI:144729) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-β-ethynylserine zwitterion (CHEBI:144729) is tautomer of L-β-ethynylserine (CHEBI:144833) |
| Incoming Relation(s) |
| L-β-ethynylserine (CHEBI:144833) is tautomer of L-β-ethynylserine zwitterion (CHEBI:144729) |
| IUPAC Name |
|---|
| 2-azaniumyl-2,4,5-trideoxy-D-threo-pent-4-ynonate |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-azaniumyl-3-hydroxypent-4-ynoate | ChEBI |
| L-β-ethynylserine zwitterion | ChEBI |
| Citations |
|---|