EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32ClNO4S |
| Net Charge | 0 |
| Average Mass | 466.043 |
| Monoisotopic Mass | 465.17406 |
| SMILES | CCCC(=NOCC(C)Oc1ccc(Cl)cc1)C1=C(O)CC(C2CCCSC2)CC1=O |
| InChI | InChI=1S/C24H32ClNO4S/c1-3-5-21(26-29-14-16(2)30-20-9-7-19(25)8-10-20)24-22(27)12-18(13-23(24)28)17-6-4-11-31-15-17/h7-10,16-18,27H,3-6,11-15H2,1-2H3 |
| InChIKey | KRQUFUKTQHISJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| profoxydim (CHEBI:144786) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| profoxydim (CHEBI:144786) has role herbicide (CHEBI:24527) |
| profoxydim (CHEBI:144786) is a aromatic ether (CHEBI:35618) |
| profoxydim (CHEBI:144786) is a cyclic ketone (CHEBI:3992) |
| profoxydim (CHEBI:144786) is a enol (CHEBI:33823) |
| profoxydim (CHEBI:144786) is a monochlorobenzenes (CHEBI:83403) |
| profoxydim (CHEBI:144786) is a organosulfur heterocyclic compound (CHEBI:38106) |
| profoxydim (CHEBI:144786) is a oxime O-ether (CHEBI:36816) |
| IUPAC Name |
|---|
| 2-{N-[2-(4-chlorophenoxy)propoxy]butanimidoyl}-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| 2-[1-[[2-(4-chlorophenoxy)propoxy]imino]butyl]-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)-2-cyclohexen-1-one | Alan Wood's Pesticides |
| 2-(1-{[2-(4-Chlorophenoxy)propoxy]imino}butyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)cyclohex-2-en-1-one | ChEBI |
| 2-{1-[2-(4-chlorophenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one | ChEBI |
| BAS 625H | PPDB |
| clefoxidim | PPDB |
| clefoxydim | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Aura | ChEBI |
| Tetris | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1028 | PPDB |
| DB14820 | DrugBank |
| profoxydim | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10121865 | Reaxys |
| CAS:139001-49-3 | ChemIDplus |
| Citations |
|---|