EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | CC=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3 |
| InChIKey | BJIOGJUNALELMI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoeugenol (CHEBI:18224) has functional parent guaiacol (CHEBI:28591) |
| isoeugenol (CHEBI:18224) has role allergen (CHEBI:50904) |
| isoeugenol (CHEBI:18224) has role sensitiser (CHEBI:139492) |
| isoeugenol (CHEBI:18224) is a alkenylbenzene (CHEBI:195237) |
| isoeugenol (CHEBI:18224) is a phenylpropanoid (CHEBI:26004) |
| Incoming Relation(s) |
| 3-methylisoeugenol (CHEBI:59083) has functional parent isoeugenol (CHEBI:18224) |
| 5-methylisoeugenol (CHEBI:59078) has functional parent isoeugenol (CHEBI:18224) |
| 6-methylisoeugenol (CHEBI:59077) has functional parent isoeugenol (CHEBI:18224) |
| isoeugenol sulfate (CHEBI:133594) has functional parent isoeugenol (CHEBI:18224) |
| cis-isoeugenol (CHEBI:50543) is a isoeugenol (CHEBI:18224) |
| trans-isoeugenol (CHEBI:50545) is a isoeugenol (CHEBI:18224) |
| IUPAC Name |
|---|
| 2-methoxy-4-(prop-1-en-1-yl)phenol |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2-methoxy-4-propen-1-ylbenzene | ChemIDplus |
| 1-Hydroxy-2-methoxy-4-propenylbenzene | NIST Chemistry WebBook |
| 2-Methoxy-4-propenylphenol | ChemIDplus |
| 3-Methoxy-4-hydroxypropenylbenzene | NIST Chemistry WebBook |
| 4-Hydroxy-3-methoxypropenylbenzene | NIST Chemistry WebBook |
| 4-Propenylguaiacol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| isoeugenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C10469 | KEGG COMPOUND |
| Isoeugenol | Wikipedia |
| Citations |
|---|