EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50543 - cis-isoeugenol
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | C/C=C\c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3/b4-3- |
| InChIKey | BJIOGJUNALELMI-ARJAWSKDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-isoeugenol (CHEBI:50543) is a isoeugenol (CHEBI:18224) |
| IUPAC Name |
|---|
| 2-methoxy-4-[(1Z)-prop-1-en-1-yl]phenol |
| Synonyms | Source |
|---|---|
| cis-2-Methoxy-4-propenylphenol | ChemIDplus |
| cis-4-Propenylguaiacol | ChemIDplus |
| iso-Eugenol 1 | NIST Chemistry WebBook |
| Isoeugenol cis-form | ChemIDplus |
| Isoeugenol (II) | NIST Chemistry WebBook |
| (Z)-2-methoxy-4-propenylphenol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Isoeugenol | Wikipedia |