EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N6O9P |
| Net Charge | -1 |
| Average Mass | 389.197 |
| Monoisotopic Mass | 389.02524 |
| SMILES | Nc1nc(=O)c2nc([N+](=O)[O-])n([C@@H]3O[C@@H]4COP(=O)([O-])O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H11N6O9P/c11-9-13-6-3(7(18)14-9)12-10(16(19)20)15(6)8-4(17)5-2(24-8)1-23-26(21,22)25-5/h2,4-5,8,17H,1H2,(H,21,22)(H3,11,13,14,18)/p-1/t2-,4-,5-,8-/m1/s1 |
| InChIKey | XRKODJJSPSPDGM-UMMCILCDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-nitroguanosine 3',5'-cyclic monophosphate(1−) (CHEBI:144462) has functional parent 3',5'-cyclic GMP(1−) (CHEBI:57746) |
| 8-nitroguanosine 3',5'-cyclic monophosphate(1−) (CHEBI:144462) is a organophosphate oxoanion (CHEBI:58945) |
| 8-nitroguanosine 3',5'-cyclic monophosphate(1−) (CHEBI:144462) is conjugate base of 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) |
| Incoming Relation(s) |
| 8-nitroguanosine 3',5'-cyclic monophosphate (CHEBI:136665) is conjugate acid of 8-nitroguanosine 3',5'-cyclic monophosphate(1−) (CHEBI:144462) |
| UniProt Name | Source |
|---|---|
| 8-nitro-cGMP | UniProt |
| Citations |
|---|