EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NS2 |
| Net Charge | 0 |
| Average Mass | 149.284 |
| Monoisotopic Mass | 149.03329 |
| SMILES | CCN(CC)C(=S)S |
| InChI | InChI=1S/C5H11NS2/c1-3-6(4-2)5(7)8/h3-4H2,1-2H3,(H,7,8) |
| InChIKey | LMBWSYZSUOEYSN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethyldithiocarbamic acid (CHEBI:144353) has role chelator (CHEBI:38161) |
| diethyldithiocarbamic acid (CHEBI:144353) has role copper chelator (CHEBI:166831) |
| diethyldithiocarbamic acid (CHEBI:144353) is a dithiocarbamic acids (CHEBI:78787) |
| diethyldithiocarbamic acid (CHEBI:144353) is conjugate acid of diethyldithiocarbamate (CHEBI:144359) |
| Incoming Relation(s) |
| zinc diethyldithiocarbamate (CHEBI:144351) has functional parent diethyldithiocarbamic acid (CHEBI:144353) |
| diethyldithiocarbamate (CHEBI:144359) is conjugate base of diethyldithiocarbamic acid (CHEBI:144353) |
| IUPAC Name |
|---|
| diethylcarbamodithioic acid |
| Synonyms | Source |
|---|---|
| Ditiocarb | ChemIDplus |
| N,N-diethylcarbamodithioic acid | ChEBI |
| N,N-diethyldithiocarbamic acid | ChEBI |
| Citations |
|---|