EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O2 |
| Net Charge | 0 |
| Average Mass | 298.511 |
| Monoisotopic Mass | 298.28718 |
| SMILES | CCCCCCCCCCCCCCCCC(C)C(=O)O |
| InChI | InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)19(20)21/h18H,3-17H2,1-2H3,(H,20,21) |
| InChIKey | GBZDALHFANHWOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyloctadecanoic acid (CHEBI:144310) has functional parent octadecanoic acid (CHEBI:28842) |
| 2-methyloctadecanoic acid (CHEBI:144310) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 2-methyloctadecanoic acid (CHEBI:144310) is a long-chain fatty acid (CHEBI:15904) |
| 2-methyloctadecanoic acid (CHEBI:144310) is a methyl-branched fatty acid (CHEBI:62499) |
| 2-methyloctadecanoic acid (CHEBI:144310) is conjugate acid of 2-methyloctadecanoate (CHEBI:143530) |
| Incoming Relation(s) |
| 2-methyloctadecanoate (CHEBI:143530) is conjugate base of 2-methyloctadecanoic acid (CHEBI:144310) |
| IUPAC Name |
|---|
| 2-methyloctadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-methylstearic acid | ChEBI |
| α-methyloctadecanoic acid | ChEBI |
| α-methylstearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020095 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:7217-83-6 | ChemIDplus |
| Citations |
|---|