EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37O2 |
| Net Charge | -1 |
| Average Mass | 297.503 |
| Monoisotopic Mass | 297.27990 |
| SMILES | CCCCCCCCCCCCCCCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)19(20)21/h18H,3-17H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | GBZDALHFANHWOF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyloctadecanoate (CHEBI:143530) is a 2-methyl fatty acid anion (CHEBI:83976) |
| 2-methyloctadecanoate (CHEBI:143530) is a fatty acid anion 19:0 (CHEBI:78892) |
| 2-methyloctadecanoate (CHEBI:143530) is a long-chain fatty acid anion (CHEBI:57560) |
| 2-methyloctadecanoate (CHEBI:143530) is conjugate base of 2-methyloctadecanoic acid (CHEBI:144310) |
| Incoming Relation(s) |
| 2-methylstearoyl-CoA(4−) (CHEBI:143531) has functional parent 2-methyloctadecanoate (CHEBI:143530) |
| 2-methyloctadecanoic acid (CHEBI:144310) is conjugate acid of 2-methyloctadecanoate (CHEBI:143530) |
| IUPAC Name |
|---|
| 2-methyloctadecanoate |
| Synonyms | Source |
|---|---|
| 2-methyloctadecanoate(1−) | SUBMITTER |
| 2-methylstearate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methyloctadecanoate | UniProt |
| Citations |
|---|