EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14F4N2O4S |
| Net Charge | 0 |
| Average Mass | 430.379 |
| Monoisotopic Mass | 430.06104 |
| SMILES | C[C@@](O)(CS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F4N2O4S/c1-17(26,10-29(27,28)14-6-3-12(19)4-7-14)16(25)24-13-5-2-11(9-23)15(8-13)18(20,21)22/h2-8,26H,10H2,1H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | LKJPYSCBVHEWIU-QGZVFWFLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-bicalutamide (CHEBI:144094) is a N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide (CHEBI:144093) |
| (S)-bicalutamide (CHEBI:144094) is enantiomer of (R)-bicalutamide (CHEBI:39589) |
| Incoming Relation(s) |
| bicalutamide (CHEBI:3090) has part (S)-bicalutamide (CHEBI:144094) |
| (R)-bicalutamide (CHEBI:39589) is enantiomer of (S)-bicalutamide (CHEBI:144094) |
| IUPAC Name |
|---|
| (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide |
| Synonyms | Source |
|---|---|
| (+)-bicalutamide | ChemIDplus |
| (S)-Casodex | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 0U9 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:113299-38-0 | ChemIDplus |
| Citations |
|---|