EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:144078 - dihydroartemisinic acid
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H][C@]12C=C(C)CC[C@@]1([H])[C@H](C)CC[C@@]2([H])[C@@H](C)C(=O)O |
| InChI | InChI=1S/C15H24O2/c1-9-4-6-12-10(2)5-7-13(14(12)8-9)11(3)15(16)17/h8,10-14H,4-7H2,1-3H3,(H,16,17)/t10-,11-,12+,13+,14+/m1/s1 |
| InChIKey | JYGAZEJXUVDYHI-DGTMBMJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia annua (ncbitaxon:35608) | - | DOI (10.1007/s11418-006-0112-9) | Identified in petals and leaves. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroartemisinic acid (CHEBI:144078) has role plant metabolite (CHEBI:76924) |
| dihydroartemisinic acid (CHEBI:144078) is a carbobicyclic compound (CHEBI:36785) |
| dihydroartemisinic acid (CHEBI:144078) is a monocarboxylic acid (CHEBI:25384) |
| dihydroartemisinic acid (CHEBI:144078) is a octahydronaphthalenes (CHEBI:138397) |
| dihydroartemisinic acid (CHEBI:144078) is a sesquiterpenoid (CHEBI:26658) |
| dihydroartemisinic acid (CHEBI:144078) is conjugate acid of dihydroartemisinate (CHEBI:143905) |
| Incoming Relation(s) |
| dihydroartemisinate (CHEBI:143905) is conjugate base of dihydroartemisinic acid (CHEBI:144078) |
| IUPAC Name |
|---|
| (2R)-2-[(1R,4R,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoic acid |
| Synonyms | Source |
|---|---|
| dihydroartemisinic acid | ChEBI |
| (−)-dihydroartemisinic acid | KNApSAcK |
| dihydroarteannuic acid | MetaCyc |
| (2R)-2-[(1R)-4β,7-Dimethyl-1,2,3,4,4aβ,5,6,8aβ-octahydronaphthalen-1α-yl]propionic acid | ChEBI |
| Citations |
|---|