EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23O2 |
| Net Charge | -1 |
| Average Mass | 235.347 |
| Monoisotopic Mass | 235.17035 |
| SMILES | [H][C@]12C=C(C)CC[C@@]1([H])[C@H](C)CC[C@@]2([H])[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C15H24O2/c1-9-4-6-12-10(2)5-7-13(14(12)8-9)11(3)15(16)17/h8,10-14H,4-7H2,1-3H3,(H,16,17)/p-1/t10-,11-,12+,13+,14+/m1/s1 |
| InChIKey | JYGAZEJXUVDYHI-DGTMBMJNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroartemisinate (CHEBI:143905) is a monocarboxylic acid anion (CHEBI:35757) |
| dihydroartemisinate (CHEBI:143905) is conjugate base of dihydroartemisinic acid (CHEBI:144078) |
| Incoming Relation(s) |
| dihydroartemisinic acid (CHEBI:144078) is conjugate acid of dihydroartemisinate (CHEBI:143905) |
| IUPAC Name |
|---|
| (2R)-2-[(1R,4R,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoate |
| UniProt Name | Source |
|---|---|
| (11R)-dihydroartemisinate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7559 | MetaCyc |
| Citations |
|---|