EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CC(C)CCCC(C)C(=O)O |
| InChI | InChI=1S/C9H18O2/c1-7(2)5-4-6-8(3)9(10)11/h7-8H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | MDAPKSVKYITQHQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia cyriacigeorgica (ncbitaxon:135487) | - | PubMed (20143352) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethylheptanoic acid (CHEBI:143886) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2,6-dimethylheptanoic acid (CHEBI:143886) is a medium-chain fatty acid (CHEBI:59554) |
| 2,6-dimethylheptanoic acid (CHEBI:143886) is a methyl-branched fatty acid (CHEBI:62499) |
| 2,6-dimethylheptanoic acid (CHEBI:143886) is conjugate acid of 2,6-dimethylheptanoate (CHEBI:143533) |
| Incoming Relation(s) |
| 2,6-dimethylheptanoate (CHEBI:143533) is conjugate base of 2,6-dimethylheptanoic acid (CHEBI:143886) |
| IUPAC Name |
|---|
| 2,6-dimethylheptanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:60148-94-9 | ChemIDplus |
| Citations |
|---|