EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17O2 |
| Net Charge | -1 |
| Average Mass | 157.233 |
| Monoisotopic Mass | 157.12340 |
| SMILES | CC(C)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C9H18O2/c1-7(2)5-4-6-8(3)9(10)11/h7-8H,4-6H2,1-3H3,(H,10,11)/p-1 |
| InChIKey | MDAPKSVKYITQHQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethylheptanoate (CHEBI:143533) is a medium-chain fatty acid anion (CHEBI:59558) |
| 2,6-dimethylheptanoate (CHEBI:143533) is a methyl-branched fatty acid anion (CHEBI:67013) |
| 2,6-dimethylheptanoate (CHEBI:143533) is conjugate base of 2,6-dimethylheptanoic acid (CHEBI:143886) |
| Incoming Relation(s) |
| 2,6-dimethylheptanoic acid (CHEBI:143886) is conjugate acid of 2,6-dimethylheptanoate (CHEBI:143533) |
| IUPAC Name |
|---|
| 2,6-dimethylheptanoate |
| Synonym | Source |
|---|---|
| 2,6-dimethylheptanoic acid(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,6-dimethylheptanoate | UniProt |
| Citations |
|---|