EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13ClN2O2 |
| Net Charge | 0 |
| Average Mass | 180.635 |
| Monoisotopic Mass | 180.06656 |
| SMILES | NCCC(Cl)C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13ClN2O2/c7-4(1-2-8)3-5(9)6(10)11/h4-5H,1-3,8-9H2,(H,10,11)/t4?,5-/m0/s1 |
| InChIKey | RARMVOFXKPZWMG-AKGZTFGVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-L-lysine zwitterion (CHEBI:143830) is a L-α-amino acid zwitterion (CHEBI:59869) |
| 4-chloro-L-lysine zwitterion (CHEBI:143830) is conjugate base of 4-chloro-L-lysinium (CHEBI:143276) |
| 4-chloro-L-lysine zwitterion (CHEBI:143830) is tautomer of 4-chloro-L-lysine (CHEBI:143829) |
| Incoming Relation(s) |
| 4-chloro-L-lysinium (CHEBI:143276) is conjugate acid of 4-chloro-L-lysine zwitterion (CHEBI:143830) |
| 4-chloro-L-lysine (CHEBI:143829) is tautomer of 4-chloro-L-lysine zwitterion (CHEBI:143830) |
| IUPAC Name |
|---|
| (2S)-6-amino-2-azaniumyl-4-chlorohexanoate |