EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13ClN2O2 |
| Net Charge | 0 |
| Average Mass | 180.635 |
| Monoisotopic Mass | 180.06656 |
| SMILES | NCCC(Cl)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13ClN2O2/c7-4(1-2-8)3-5(9)6(10)11/h4-5H,1-3,8-9H2,(H,10,11)/t4?,5-/m0/s1 |
| InChIKey | RARMVOFXKPZWMG-AKGZTFGVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-L-lysine (CHEBI:143829) is a L-lysine derivative (CHEBI:25095) |
| 4-chloro-L-lysine (CHEBI:143829) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 4-chloro-L-lysine (CHEBI:143829) is a organochlorine compound (CHEBI:36683) |
| 4-chloro-L-lysine (CHEBI:143829) is tautomer of 4-chloro-L-lysine zwitterion (CHEBI:143830) |
| Incoming Relation(s) |
| 4-chloro-L-lysine zwitterion (CHEBI:143830) is tautomer of 4-chloro-L-lysine (CHEBI:143829) |
| IUPAC Name |
|---|
| 4-chloro-L-lysine |
| Synonym | Source |
|---|---|
| 4-Cl-L-lysine | ChEBI |