EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O2 |
| Net Charge | 0 |
| Average Mass | 282.468 |
| Monoisotopic Mass | 282.25588 |
| SMILES | CCCC/C=C/CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-6H,2-4,7-17H2,1H3,(H,19,20)/b6-5+ |
| InChIKey | BDLLSHRIFPDGQB-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (27450370) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13E)-octadecenoic acid (CHEBI:143770) has role human metabolite (CHEBI:77746) |
| (13E)-octadecenoic acid (CHEBI:143770) is a fatty acid 18:1 (CHEBI:140948) |
| (13E)-octadecenoic acid (CHEBI:143770) is a octadecenoic acid (CHEBI:25634) |
| IUPAC Name |
|---|
| (13E)-octadec-13-enoic acid |
| Synonyms | Source |
|---|---|
| (13E)-octadecenoic acid | ChEBI |
| (E)-13-octadecenoic acid | HMDB |
| (E)-octadec-13-enoic acid | ChEBI |
| trans-13-octadecenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0062218 | HMDB |
| LMFA01030880 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:693-71-0 | ChEBI |
| Citations |
|---|