EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:143439 - didesethylflurazepam
| Formula | C17H15ClFN3O |
| Net Charge | 0 |
| Average Mass | 331.778 |
| Monoisotopic Mass | 331.08877 |
| SMILES | NCCN1C(=O)CN=C(c2ccccc2F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H15ClFN3O/c18-11-5-6-15-13(9-11)17(12-3-1-2-4-14(12)19)21-10-16(23)22(15)8-7-20/h1-6,9H,7-8,10,20H2 |
| InChIKey | MVAUDJDXZPBWOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | GABAA receptor agonist A GABA receptor agonist specific for GABAA receptors, ligand-gated ion channels (also known as ionotropic receptors). anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anticonvulsant A drug used to prevent seizures or reduce their severity. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| didesethylflurazepam (CHEBI:143439) has role anticonvulsant (CHEBI:35623) |
| didesethylflurazepam (CHEBI:143439) has role anxiolytic drug (CHEBI:35474) |
| didesethylflurazepam (CHEBI:143439) has role drug metabolite (CHEBI:49103) |
| didesethylflurazepam (CHEBI:143439) has role GABAA receptor agonist (CHEBI:91016) |
| didesethylflurazepam (CHEBI:143439) has role sedative (CHEBI:35717) |
| didesethylflurazepam (CHEBI:143439) is a 1,4-benzodiazepinone (CHEBI:35500) |
| didesethylflurazepam (CHEBI:143439) is a monofluorobenzenes (CHEBI:83575) |
| didesethylflurazepam (CHEBI:143439) is a organochlorine compound (CHEBI:36683) |
| didesethylflurazepam (CHEBI:143439) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 1-(2-aminoethyl)-7-chloro-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| Synonyms | Source |
|---|---|
| dealkylflurazepam | ChemIDplus |
| desalkylflurazepam | ChemIDplus |
| dideethylflurazepam | ChemIDplus |
| N,N-bisdesethylflurazepam | ChemIDplus |
| Ro 7-1986 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:17617-59-3 | ChemIDplus |
| CAS:17617-59-3 | NIST Chemistry WebBook |
| Citations |
|---|