EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO4 |
| Net Charge | 0 |
| Average Mass | 281.352 |
| Monoisotopic Mass | 281.16271 |
| SMILES | CC(C)NCC(O)COc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C15H23NO4/c1-11(2)16-9-13(17)10-20-14-6-3-12(4-7-14)5-8-15(18)19/h3-4,6-7,11,13,16-17H,5,8-10H2,1-2H3,(H,18,19) |
| InChIKey | ILSCWPMGTDPATI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoic acid (CHEBI:143310) is a carboxylic acid (CHEBI:33575) |
| 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoic acid (CHEBI:143310) is a ethanolamines (CHEBI:23981) |
| 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoic acid (CHEBI:143310) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| esmolol (CHEBI:4856) has functional parent 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoic acid (CHEBI:143310) |
| methyl 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate (CHEBI:88206) has functional parent 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoic acid (CHEBI:143310) |
| IUPAC Name |
|---|
| 3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoic acid |
| Synonym | Source |
|---|---|
| 3-{4-[2-hydroxy-3-(isopropylamino)propoxy]phenyl}propionic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5284008 | Reaxys |
| CAS:81148-15-4 | ChemIDplus |