EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO4 |
| Net Charge | 0 |
| Average Mass | 167.120 |
| Monoisotopic Mass | 167.02186 |
| SMILES | O=Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C7H5NO4/c9-6-2-1-4(8-12)3-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | UNQLIDLZZNHURS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-nitrososalicylic acid (CHEBI:143303) has functional parent salicylic acid (CHEBI:16914) |
| 5-nitrososalicylic acid (CHEBI:143303) is a hydroxybenzoic acid (CHEBI:24676) |