EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12NO4P |
| Net Charge | 0 |
| Average Mass | 181.128 |
| Monoisotopic Mass | 181.05039 |
| SMILES | CP(=O)(O)CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H12NO4P/c1-11(9,10)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10)/t4-/m1/s1 |
| InChIKey | IAJOBQBIJHVGMQ-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-glufosinate (CHEBI:142853) is a 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid (CHEBI:142851) |
| (2R)-glufosinate (CHEBI:142853) is enantiomer of glufosinate-P (CHEBI:142852) |
| (2R)-glufosinate (CHEBI:142853) is tautomer of (2R)-glufosinate zwitterion (CHEBI:142854) |
| Incoming Relation(s) |
| glufosinate (CHEBI:52136) has part (2R)-glufosinate (CHEBI:142853) |
| glufosinate-P (CHEBI:142852) is enantiomer of (2R)-glufosinate (CHEBI:142853) |
| (2R)-glufosinate zwitterion (CHEBI:142854) is tautomer of (2R)-glufosinate (CHEBI:142853) |
| IUPAC Names |
|---|
| (2R)-2-amino-4-[hydroxy(methyl)phosphinoyl]butyric acid |
| (2R)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-4-(hydroxymethylphosphinyl)butanoic acid | ChEBI |
| 4-[hydroxy(methyl)phosphinoyl]-D-homoalanine | ChEBI |
| (−)-glufosinate | ChEBI |
| (R)-glufosinate | ChEBI |
| D-glufosinate | ChEBI |