EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12NO4P |
| Net Charge | 0 |
| Average Mass | 181.128 |
| Monoisotopic Mass | 181.05039 |
| SMILES | CP(=O)(O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12NO4P/c1-11(9,10)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10)/t4-/m0/s1 |
| InChIKey | IAJOBQBIJHVGMQ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor An EC 6.3.* (C‒N bond-forming ligase) inhibitor that interferes with the action of glutamate—ammonia ligase (EC 6.3.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glufosinate-P (CHEBI:142852) has role agrochemical (CHEBI:33286) |
| glufosinate-P (CHEBI:142852) has role EC 6.3.1.2 (glutamate—ammonia ligase) inhibitor (CHEBI:24319) |
| glufosinate-P (CHEBI:142852) has role herbicide (CHEBI:24527) |
| glufosinate-P (CHEBI:142852) is a 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid (CHEBI:142851) |
| glufosinate-P (CHEBI:142852) is enantiomer of (2R)-glufosinate (CHEBI:142853) |
| glufosinate-P (CHEBI:142852) is tautomer of glufosinate-P zwitterion (CHEBI:142856) |
| Incoming Relation(s) |
| glufosinate (CHEBI:52136) has part glufosinate-P (CHEBI:142852) |
| (2R)-glufosinate (CHEBI:142853) is enantiomer of glufosinate-P (CHEBI:142852) |
| glufosinate-P zwitterion (CHEBI:142856) is tautomer of glufosinate-P (CHEBI:142852) |
| IUPAC Names |
|---|
| (2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid |
| (2S)-2-amino-4-[hydroxy(methyl)phosphinoyl]butyric acid |
| Synonyms | Source |
|---|---|
| (+)-glufosinate | ChEBI |
| (2S)-2-amino-4-(hydroxymethylphosphinyl)butanoic acid | Alan Wood's Pesticides |
| 4-[hydroxy(methyl)phosphinoyl]-L-homoalanine | Alan Wood's Pesticides |
| (S)-glufosinate | ChEBI |
| (2S)-glufosinate | ChEBI |
| (S)-phosphinothricin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1667 | PPDB |
| glufosinate-p | Alan Wood's Pesticides |
| PPQ | PDBeChem |
| C04650 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4668102 | Reaxys |
| CAS:35597-44-5 | Alan Wood's Pesticides |
| CAS:35597-44-5 | ChemIDplus |