EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O7 |
| Net Charge | 0 |
| Average Mass | 486.605 |
| Monoisotopic Mass | 486.26175 |
| SMILES | [H][C@@]12C=C(C)[C@@]3(C)C(=O)C(C)=C(O)[C@@]3(C(=O)OC)[C@@]1(C)CC[C@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@@]21C=O |
| InChI | InChI=1S/C28H38O7/c1-15-13-19-25(6,28(23(33)34-8)22(32)16(2)21(31)26(15,28)7)11-9-18-24(4,5)20(35-17(3)30)10-12-27(18,19)14-29/h13-14,18-20,32H,9-12H2,1-8H3/t18-,19-,20+,25+,26+,27+,28-/m1/s1 |
| InChIKey | SNSSSENJBPCLPM-OXILWVMOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium roqueforti (ncbitaxon:5082) | |||
| - | PubMed (19837474) | ||
| - | PubMed (15826038) | ||
| Penicillium albocoremium (ncbitaxon:74831) | - | PubMed (16279417) | |
| Penicillium simplicissimum (ncbitaxon:69488) | - | PubMed (8682716) | Strain: FO-3929 |
| Penicillium camponotum (ncbitaxon:2072477) | - | PubMed (27616792) | |
| Penicillium cataractarum (ncbitaxon:2100454) | - | PubMed (27616792) | |
| Penicillium costaricense (ncbitaxon:2100456) | - | PubMed (27616792) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| andrastin A (CHEBI:142842) has functional parent andrastin B (CHEBI:142862) |
| andrastin A (CHEBI:142842) has role Penicillium metabolite (CHEBI:76964) |
| andrastin A (CHEBI:142842) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| andrastin A (CHEBI:142842) is a 15-hydroxy steroid (CHEBI:38089) |
| andrastin A (CHEBI:142842) is a 17-oxo steroid (CHEBI:19168) |
| andrastin A (CHEBI:142842) is a 19-oxo steroid (CHEBI:38149) |
| andrastin A (CHEBI:142842) is a 5β steroid (CHEBI:136889) |
| andrastin A (CHEBI:142842) is a acetate ester (CHEBI:47622) |
| andrastin A (CHEBI:142842) is a enol (CHEBI:33823) |
| andrastin A (CHEBI:142842) is a meroterpenoid (CHEBI:64419) |
| andrastin A (CHEBI:142842) is a methyl ester (CHEBI:25248) |
| andrastin A (CHEBI:142842) is a steroid aldehyde (CHEBI:131565) |
| andrastin A (CHEBI:142842) is conjugate acid of andrastin A(1−) (CHEBI:142823) |
| Incoming Relation(s) |
| andrastin A(1−) (CHEBI:142823) is conjugate base of andrastin A (CHEBI:142842) |
| IUPAC Name |
|---|
| methyl 3β-acetoxy-15-hydroxy-4,4,8α,12,16-pentamethyl-17,19-dioxo-5β,9β,10α,13α-androsta-11,15-diene-14-carboxylate |
| Synonym | Source |
|---|---|
| methyl (3β,5β,8α,9β,10α,13α)-3-acetoxy-15-hydroxy-4,4,8,12,16-pentamethyl-17,19-dioxoandrosta-11,15-diene-14-carboxylate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| Andrastin_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:174232-42-9 | ChEBI |
| Citations |
|---|