EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O4 |
| Net Charge | 0 |
| Average Mass | 396.487 |
| Monoisotopic Mass | 396.20491 |
| SMILES | [H][C@@]12CCN(CCc3c(nc4ccccc34)[C@@]1(COC(C)=O)C(=O)OC)C/C2=C/C |
| InChI | InChI=1S/C23H28N2O4/c1-4-16-13-25-11-9-18-17-7-5-6-8-20(17)24-21(18)23(22(27)28-3,14-29-15(2)26)19(16)10-12-25/h4-8,19,24H,9-14H2,1-3H3/b16-4-/t19-,23-/m0/s1 |
| InChIKey | ZNCUMLJVNWXVLT-ISNKGDJGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetyl-15α-stemmadenine (CHEBI:142836) is a acetate ester (CHEBI:47622) |
| O-acetyl-15α-stemmadenine (CHEBI:142836) is a methyl ester (CHEBI:25248) |
| O-acetyl-15α-stemmadenine (CHEBI:142836) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| O-acetyl-15α-stemmadenine (CHEBI:142836) is a organic heterotetracyclic compound (CHEBI:38163) |
| O-acetyl-15α-stemmadenine (CHEBI:142836) is conjugate base of O-acetyl-15α-stemmadenine(1+) (CHEBI:142673) |
| Incoming Relation(s) |
| O-acetyl-15α-stemmadenine(1+) (CHEBI:142673) is conjugate acid of O-acetyl-15α-stemmadenine (CHEBI:142836) |
| IUPAC Name |
|---|
| methyl (5E,6S,7S)-7-(acetoxymethyl)-5-ethylidene-1,4,5,6,7,8-hexahydro-2H-3,6-ethanoazonino[5,4-b]indole-7-carboxylate |
| Citations |
|---|