EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29N2O4 |
| Net Charge | +1 |
| Average Mass | 397.495 |
| Monoisotopic Mass | 397.21218 |
| SMILES | [H][C@@]12CC[NH+](CCc3c(nc4ccccc34)[C@@]1(COC(C)=O)C(=O)OC)C/C2=C/C |
| InChI | InChI=1S/C23H28N2O4/c1-4-16-13-25-11-9-18-17-7-5-6-8-20(17)24-21(18)23(22(27)28-3,14-29-15(2)26)19(16)10-12-25/h4-8,19,24H,9-14H2,1-3H3/p+1/b16-4-/t19-,23-/m0/s1 |
| InChIKey | ZNCUMLJVNWXVLT-ISNKGDJGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetyl-15α-stemmadenine(1+) (CHEBI:142673) is a ammonium ion derivative (CHEBI:35274) |
| O-acetyl-15α-stemmadenine(1+) (CHEBI:142673) is conjugate acid of O-acetyl-15α-stemmadenine (CHEBI:142836) |
| Incoming Relation(s) |
| O-acetyl-15α-stemmadenine (CHEBI:142836) is conjugate base of O-acetyl-15α-stemmadenine(1+) (CHEBI:142673) |
| UniProt Name | Source |
|---|---|
| O-acetyl-15α-stemmadenine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21548 | MetaCyc |
| Citations |
|---|