EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39O7 |
| Net Charge | -1 |
| Average Mass | 487.613 |
| Monoisotopic Mass | 487.27013 |
| SMILES | [H][C@@]12C=C(C)[C@@]3(C)C(=O)C(C)=C([O-])[C@@]3(C(=O)OC)[C@@]1(C)CC[C@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@@]21CO |
| InChI | InChI=1S/C28H40O7/c1-15-13-19-25(6,28(23(33)34-8)22(32)16(2)21(31)26(15,28)7)11-9-18-24(4,5)20(35-17(3)30)10-12-27(18,19)14-29/h13,18-20,29,32H,9-12,14H2,1-8H3/p-1/t18-,19-,20+,25+,26+,27+,28-/m1/s1 |
| InChIKey | HWVZMVZNLKRRLT-OXILWVMOSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| andrastin B(1−) (CHEBI:142822) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| andrastin B(1−) (CHEBI:142822) is a enolate (CHEBI:142839) |
| andrastin B(1−) (CHEBI:142822) is conjugate base of andrastin B (CHEBI:142862) |
| Incoming Relation(s) |
| andrastin B (CHEBI:142862) is conjugate acid of andrastin B(1−) (CHEBI:142822) |
| IUPAC Name |
|---|
| 3β-(acetyloxy)-14-(methoxycarbonyl)-4,4,8α,12,16-pentamethyl-17,19-dioxo-5β,9β,10α,13α-androsta-11,15-dien-15-olate |
| Synonym | Source |
|---|---|
| (3β,5β,8α,9β,10α,13α)-3-(acetyloxy)-14-(methoxycarbonyl)-4,4,8,12,16-pentamethyl-17,19-dioxoandrosta-11,15-dien-15-olate | IUPAC |
| UniProt Name | Source |
|---|---|
| andrastin B | UniProt |