EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39O6 |
| Net Charge | -1 |
| Average Mass | 471.614 |
| Monoisotopic Mass | 471.27521 |
| SMILES | [H][C@@]12C=C(C)[C@@]3(C)C(=O)C(C)=C([O-])[C@@]3(C(=O)OC)[C@@]1(C)CC[C@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@@]21C |
| InChI | InChI=1S/C28H40O6/c1-15-14-19-25(6)12-11-20(34-17(3)29)24(4,5)18(25)10-13-26(19,7)28(23(32)33-9)22(31)16(2)21(30)27(15,28)8/h14,18-20,31H,10-13H2,1-9H3/p-1/t18-,19+,20+,25-,26+,27+,28-/m1/s1 |
| InChIKey | COPIXBGZYYCWRA-QUQNHZJXSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| andrastin C(1−) (CHEBI:142821) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| andrastin C(1−) (CHEBI:142821) is a enolate (CHEBI:142839) |
| andrastin C(1−) (CHEBI:142821) is conjugate base of andrastin C (CHEBI:142867) |
| Incoming Relation(s) |
| andrastin C (CHEBI:142867) is conjugate acid of andrastin C(1−) (CHEBI:142821) |
| IUPAC Name |
|---|
| 3β-(acetyloxy)-14-(methoxycarbonyl)-4,4,8α,12,16-pentamethyl-17-oxo-5β,9β,10α,13α-androsta-11,15-dien-15-olate |
| Synonym | Source |
|---|---|
| (3β,5β,8α,9β,10α,13α)-3-(acetyloxy)-14-(methoxycarbonyl)-4,4,8,12,16-pentamethyl-17-oxoandrosta-11,15-dien-15-olate | IUPAC |
| UniProt Name | Source |
|---|---|
| andrastin C | UniProt |