EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35O5 |
| Net Charge | -1 |
| Average Mass | 427.561 |
| Monoisotopic Mass | 427.24900 |
| SMILES | [H][C@@]12C=C(C)[C@@]3(C)C(=O)C(C)=C([O-])[C@@]3(C(=O)OC)[C@@]1(C)CC[C@]1([H])C(C)(C)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C26H36O5/c1-14-13-17-23(5)11-10-18(27)22(3,4)16(23)9-12-24(17,6)26(21(30)31-8)20(29)15(2)19(28)25(14,26)7/h13,16-17,29H,9-12H2,1-8H3/p-1/t16-,17+,23-,24+,25+,26-/m1/s1 |
| InChIKey | OVCUEWPSMQMSOY-UWWAQUNASA-M |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| andrastin D(1−) (CHEBI:142819) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| andrastin D(1−) (CHEBI:142819) is a enolate (CHEBI:142839) |
| andrastin D(1−) (CHEBI:142819) is conjugate base of andrastin D (CHEBI:142874) |
| Incoming Relation(s) |
| andrastin D (CHEBI:142874) is conjugate acid of andrastin D(1−) (CHEBI:142819) |
| IUPAC Name |
|---|
| 14-(methoxycarbonyl)-4,4,8α,12,16-pentamethyl-3,17-dioxo-5β,9β,10α,13α-androsta-11,15-dien-15-olate |
| Synonym | Source |
|---|---|
| (5β,8α,9β,10α,13α)-14-(methoxycarbonyl)-4,4,8,12,16-pentamethyl-3,17-dioxoandrosta-11,15-dien-15-olate | IUPAC |
| UniProt Name | Source |
|---|---|
| andrastin D | UniProt |