EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O4 |
| Net Charge | 0 |
| Average Mass | 232.320 |
| Monoisotopic Mass | 232.16746 |
| SMILES | CCCCCCCCCC(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H24O4/c1-2-3-4-5-6-7-8-9-10(13)11(14)12(15)16/h10-11,13-14H,2-9H2,1H3,(H,15,16) |
| InChIKey | JJIJQULYODNGKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxydodecanoic acid (CHEBI:142580) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 2,3-dihydroxydodecanoic acid (CHEBI:142580) is a medium-chain fatty acid (CHEBI:59554) |
| 2,3-dihydroxydodecanoic acid (CHEBI:142580) is conjugate acid of 2,3-dihydroxydodecanoate (CHEBI:141780) |
| Incoming Relation(s) |
| 2,3-dihydroxydodecanoate (CHEBI:141780) is conjugate base of 2,3-dihydroxydodecanoic acid (CHEBI:142580) |
| IUPAC Name |
|---|
| 2,3-dihydroxydodecanoic acid |
| Synonym | Source |
|---|---|
| 2,3-dihydroxylauric acid | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1780920 | Reaxys |
| Citations |
|---|