EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23O4 |
| Net Charge | -1 |
| Average Mass | 231.312 |
| Monoisotopic Mass | 231.16018 |
| SMILES | CCCCCCCCCC(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C12H24O4/c1-2-3-4-5-6-7-8-9-10(13)11(14)12(15)16/h10-11,13-14H,2-9H2,1H3,(H,15,16)/p-1 |
| InChIKey | JJIJQULYODNGKJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxydodecanoate (CHEBI:141780) has functional parent dodecanoate (CHEBI:18262) |
| 2,3-dihydroxydodecanoate (CHEBI:141780) is a 2-hydroxy fatty acid anion (CHEBI:76176) |
| 2,3-dihydroxydodecanoate (CHEBI:141780) is a 3-hydroxy fatty acid anion (CHEBI:84196) |
| 2,3-dihydroxydodecanoate (CHEBI:141780) is a medium-chain fatty acid anion (CHEBI:59558) |
| 2,3-dihydroxydodecanoate (CHEBI:141780) is conjugate base of 2,3-dihydroxydodecanoic acid (CHEBI:142580) |
| Incoming Relation(s) |
| 2,3-dihydroxydodecanoic acid (CHEBI:142580) is conjugate acid of 2,3-dihydroxydodecanoate (CHEBI:141780) |
| IUPAC Name |
|---|
| 2,3-dihydroxydodecanoate |
| Synonym | Source |
|---|---|
| 2,3-dihydroxylaurate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2,3-dihydroxydodecanoate | UniProt |
| Citations |
|---|