EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H50O4 |
| Net Charge | 0 |
| Average Mass | 414.671 |
| Monoisotopic Mass | 414.37091 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-23-24(27)22-26/h24,26-27H,2-23H2,1H3 |
| InChIKey | OKMWKBLSFKFYGZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sapium baccatum (ncbitaxon:1679265) | bark (BTO:0001301) | PubMed (24697194) | Isolated from stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-behenoylglycerol (CHEBI:142497) has functional parent docosanoic acid (CHEBI:28941) |
| 1-behenoylglycerol (CHEBI:142497) has functional parent glycerol (CHEBI:17754) |
| 1-behenoylglycerol (CHEBI:142497) has role antineoplastic agent (CHEBI:35610) |
| 1-behenoylglycerol (CHEBI:142497) has role plant metabolite (CHEBI:76924) |
| 1-behenoylglycerol (CHEBI:142497) is a 1-monoglyceride (CHEBI:35759) |
| 1-behenoylglycerol (CHEBI:142497) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl docosanoate |
| Synonyms | Source |
|---|---|
| 1-acylglycerol 22:0 | SUBMITTER |
| 1-O-docosanoylglycerol | ChEBI |
| docosanoic acid 2',3'-dihydroxypropyl ester | ChEBI |
| glycerol behenate | ChEBI |
| glycerol-behenic acid monoester | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-docosanoylglycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1886911 | Reaxys |
| CAS:30233-64-8 | ChemIDplus |
| Citations |
|---|