EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO |
| Net Charge | 0 |
| Average Mass | 265.356 |
| Monoisotopic Mass | 265.14666 |
| SMILES | [H]/C(CCNC)=C1\c2ccccc2COc2ccccc21 |
| InChI | InChI=1S/C18H19NO/c1-19-12-6-10-16-15-8-3-2-7-14(15)13-20-18-11-5-4-9-17(16)18/h2-5,7-11,19H,6,12-13H2,1H3/b16-10- |
| InChIKey | HVKCEFHNSNZIHO-YBEGLDIGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-desmethyldoxepin (CHEBI:142339) is a desmethyldoxepin (CHEBI:141547) |
| IUPAC Name |
|---|
| (3Z)-3-(dibenzo[b,e]oxepin-11(6H)-ylidene)-N-methylpropan-1-amine |
| Synonyms | Source |
|---|---|
| cis-desmethyldoxepin | ChEBI |
| cis-N-desmethyldoxepin | ChemIDplus |
| (Z)-desmethyldoxepin | ChEBI |
| (Z)-N-desmethyldoxepin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6483007 | Reaxys |
| CAS:58534-46-6 | ChemIDplus |
| Citations |
|---|