EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO |
| Net Charge | 0 |
| Average Mass | 265.356 |
| Monoisotopic Mass | 265.14666 |
| SMILES | [H]C(CCNC)=C1c2ccccc2COc2ccccc21 |
| InChI | InChI=1S/C18H19NO/c1-19-12-6-10-16-15-8-3-2-7-14(15)13-20-18-11-5-4-9-17(16)18/h2-5,7-11,19H,6,12-13H2,1H3 |
| InChIKey | HVKCEFHNSNZIHO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmethyldoxepin (CHEBI:141547) has role antidepressant (CHEBI:35469) |
| desmethyldoxepin (CHEBI:141547) has role drug metabolite (CHEBI:49103) |
| desmethyldoxepin (CHEBI:141547) is a cyclic ether (CHEBI:37407) |
| desmethyldoxepin (CHEBI:141547) is a dibenzooxepine (CHEBI:38926) |
| desmethyldoxepin (CHEBI:141547) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| (E)-desmethyldoxepin (CHEBI:142340) is a desmethyldoxepin (CHEBI:141547) |
| (Z)-desmethyldoxepin (CHEBI:142339) is a desmethyldoxepin (CHEBI:141547) |
| IUPAC Name |
|---|
| 3-(dibenzo[b,e]oxepin-11(6H)-ylidene)-N-methylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 11-(3-methylamino-propyliden)-dibenzo[b,e]oxepin | ChEBI |
| 3-(6H-dibenz[b,e]oxepin-11-ylidene)-N-methylpropylamine | ChEBI |
| 3-(dibenzo[b,e]oxepin-11(6H)-ylidene)-N-methyl-1-propanamine | ChEBI |
| demethyldoxepin | ChemIDplus |
| desmethyldoxepin | ChEBI |
| desmethyldoxepine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060840 | HMDB |
| Nordoxepin | Wikipedia |
| WO2007136741 | Patent |
| Citations |
|---|