EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | [H][C@@]1(C2=CCCC(C)(C)C2)CC=C(C(=O)O)CC1 |
| InChI | InChI=1S/C15H22O2/c1-15(2)9-3-4-13(10-15)11-5-7-12(8-6-11)14(16)17/h4,7,11H,3,5-6,8-10H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | IQKSHFZTCNUYOT-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zealexin A1 (CHEBI:142278) has functional parent (S)-β-macrocarpen-15-ol (CHEBI:141850) |
| zealexin A1 (CHEBI:142278) is a sesquiterpene phytoalexin (CHEBI:142279) |
| zealexin A1 (CHEBI:142278) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| zealexin A1 (CHEBI:142278) is conjugate acid of zealexin A1(1−) (CHEBI:141852) |
| Incoming Relation(s) |
| zealexin A1(1−) (CHEBI:141852) is conjugate base of zealexin A1 (CHEBI:142278) |
| IUPAC Name |
|---|
| (1S)-5',5'-dimethyl[1,1'-bi(cyclohexane)-1',3-diene]-4-carboxylic acid |
| Synonym | Source |
|---|---|
| (4S)-4-(5,5-dimethylcyclohex-1-en-1-yl)-cyclohex-1-ene-1-carboxylic acid | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-13573 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28861710 | Reaxys |
| Citations |
|---|