EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C1CC(O)(c2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H12O6/c16-9-3-1-8(2-4-9)15(20)7-12(19)14-11(18)5-10(17)6-13(14)21-15/h1-6,16-18,20H,7H2 |
| InChIKey | NFENYLPEYDNIMO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus kousa (ncbitaxon:28501) | stem (BTO:0001300) | PubMed (17661332) | |
| Abies spectabilis (ncbitaxon:342581) | aerial part (BTO:0001658) | PubMed (21139272) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one (CHEBI:142230) has role plant metabolite (CHEBI:76924) |
| 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one (CHEBI:142230) is a 2-hydroxyflavanones (CHEBI:141992) |
| 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one (CHEBI:142230) is a tetrahydroxyflavanone (CHEBI:38742) |
| Incoming Relation(s) |
| (2R)-2-hydroxynaringenin (CHEBI:142229) is a 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one (CHEBI:142230) |
| (2S)-2-hydroxynaringenin (CHEBI:141994) is a 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one (CHEBI:142230) |
| IUPAC Name |
|---|
| 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-hydroxynaringenin | ChEBI |
| 2,4',5,7-tetrahydroxyflavanone | HMDB |
| 2,3-dihydro-2,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | HMDB |
| 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-3H-chromen-4-one | ChEBI |
| 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-3H-1-benzopyran-4-one | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040314 | HMDB |
| CPD-15074 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7254315 | Reaxys |
| Citations |
|---|