EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C1C[C@@](O)(c2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H12O6/c16-9-3-1-8(2-4-9)15(20)7-12(19)14-11(18)5-10(17)6-13(14)21-15/h1-6,16-18,20H,7H2/t15-/m0/s1 |
| InChIKey | NFENYLPEYDNIMO-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-hydroxynaringenin (CHEBI:141994) has functional parent (S)-naringenin (CHEBI:17846) |
| (2S)-2-hydroxynaringenin (CHEBI:141994) is a 2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one (CHEBI:142230) |
| (2S)-2-hydroxynaringenin (CHEBI:141994) is enantiomer of (2R)-2-hydroxynaringenin (CHEBI:142229) |
| Incoming Relation(s) |
| (2R)-2-hydroxynaringenin (CHEBI:142229) is enantiomer of (2S)-2-hydroxynaringenin (CHEBI:141994) |
| IUPAC Name |
|---|
| (2S)-2,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (S)-2-hydroxynaringenin | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S)-2-hydroxynaringenin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2476057 | Reaxys |