EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@@H]1CCC2=CCC[C@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13+,15+/m0/s1 |
| InChIKey | QEBNYNLSCGVZOH-GZBFAFLISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-eremophilene (CHEBI:142091) is a octahydronaphthalenes (CHEBI:138397) |
| (−)-eremophilene (CHEBI:142091) is a polycyclic olefin (CHEBI:35714) |
| (−)-eremophilene (CHEBI:142091) is a sesquiterpene (CHEBI:35189) |
| (−)-eremophilene (CHEBI:142091) is enantiomer of (+)-eremophilene (CHEBI:137562) |
| Incoming Relation(s) |
| (+)-eremophilene (CHEBI:137562) is enantiomer of (−)-eremophilene (CHEBI:142091) |
| IUPAC Name |
|---|
| (3R,4aR,5S)-4a,5-dimethyl-3-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| Synonyms | Source |
|---|---|
| (1S-(1α,7α,8aα))-1,2,3,5,6,7,8,8a-octahydro-1,8a-dimethyl-7-(1-methylethenyl)-naphthalene | ChemIDplus |
| (1S,7R,8aR)-1,2,3,5,6,7,8,8a-octahydro-1,8a-dimethyl-7-(1-methylethenyl)-naphthalene | ChemIDplus |
| eremophila-1(10),11-diene | ChemIDplus |
| eremophilene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2554904 | Reaxys |
| CAS:10219-75-7 | ChemIDplus |
| CAS:10219-75-7 | NIST Chemistry WebBook |
| Citations |
|---|