EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@H]1CCC2=CCC[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13+,15+/m1/s1 |
| InChIKey | QEBNYNLSCGVZOH-IPYPFGDCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-eremophilene (CHEBI:137562) is a octahydronaphthalenes (CHEBI:138397) |
| (+)-eremophilene (CHEBI:137562) is a polycyclic olefin (CHEBI:35714) |
| (+)-eremophilene (CHEBI:137562) is a sesquiterpene (CHEBI:35189) |
| (+)-eremophilene (CHEBI:137562) is enantiomer of (−)-eremophilene (CHEBI:142091) |
| Incoming Relation(s) |
| (−)-eremophilene (CHEBI:142091) is enantiomer of (+)-eremophilene (CHEBI:137562) |
| IUPAC Name |
|---|
| (3S,4aS,5R)-4a,5-dimethyl-3-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| UniProt Name | Source |
|---|---|
| (+)-eremophilene | UniProt |
| Citations |
|---|