EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22Cl2N4O |
| Net Charge | 0 |
| Average Mass | 489.406 |
| Monoisotopic Mass | 488.11707 |
| SMILES | Cn1cncc1[C@@](N)(c1ccc(Cl)cc1)c1ccc2c(c1)c(-c1cccc(Cl)c1)cc(=O)n2C |
| InChI | InChI=1S/C27H22Cl2N4O/c1-32-16-31-15-25(32)27(30,18-6-9-20(28)10-7-18)19-8-11-24-23(13-19)22(14-26(34)33(24)2)17-4-3-5-21(29)12-17/h3-16H,30H2,1-2H3/t27-/m1/s1 |
| InChIKey | PLHJCIYEEKOWNM-HHHXNRCGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tipifarnib (CHEBI:141969) has role antineoplastic agent (CHEBI:35610) |
| tipifarnib (CHEBI:141969) has role apoptosis inducer (CHEBI:68495) |
| tipifarnib (CHEBI:141969) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| tipifarnib (CHEBI:141969) is a imidazoles (CHEBI:24780) |
| tipifarnib (CHEBI:141969) is a monochlorobenzenes (CHEBI:83403) |
| tipifarnib (CHEBI:141969) is a primary amino compound (CHEBI:50994) |
| tipifarnib (CHEBI:141969) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 6-[(R)-amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl]-4-(3-chlorophenyl)-1-methylquinolin-2(1H)-one |
| INNs | Source |
|---|---|
| tipifarnib | WHO MedNet |
| tipifarnib | WHO MedNet |
| tipifarnib | WHO MedNet |
| tipifarnibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+)-(R)-6-[amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl]-4-(3-chlorophenyl)-1-methyl-2(1H)-quinolinone | ChEBI |
| (R)-6-(amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl)-4-(3-chlorophenyl)-1-methyl-2(1H)-quinolinone | ChemIDplus |
| R-115777 | DrugBank |
| R115777 | DrugBank |
| Brand Name | Source |
|---|---|
| Zarnestra | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D03720 | KEGG DRUG |
| DB04960 | DrugBank |
| Tipifarnib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9734901 | Reaxys |
| CAS:192185-72-1 | ChemIDplus |
| Citations |
|---|