EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22Cl2N4O |
| Net Charge | 0 |
| Average Mass | 489.406 |
| Monoisotopic Mass | 488.11707 |
| SMILES | Cn1cncc1[C@@](N)(c1ccc(Cl)cc1)c1ccc2c(c1)c(-c1cccc(Cl)c1)cc(=O)n2C |
| InChI | InChI=1S/C27H22Cl2N4O/c1-32-16-31-15-25(32)27(30,18-6-9-20(28)10-7-18)19-8-11-24-23(13-19)22(14-26(34)33(24)2)17-4-3-5-21(29)12-17/h3-16H,30H2,1-2H3/t27-/m1/s1 |
| InChIKey | PLHJCIYEEKOWNM-HHHXNRCGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.5.1.58 (protein farnesyltransferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein farnesyltransferase (EC 2.5.1.58), one of the three enzymes in the prenyltransferase group. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tipifarnib (CHEBI:141969) has role antineoplastic agent (CHEBI:35610) |
| tipifarnib (CHEBI:141969) has role apoptosis inducer (CHEBI:68495) |
| tipifarnib (CHEBI:141969) has role EC 2.5.1.58 (protein farnesyltransferase) inhibitor (CHEBI:64133) |
| tipifarnib (CHEBI:141969) is a imidazoles (CHEBI:24780) |
| tipifarnib (CHEBI:141969) is a monochlorobenzenes (CHEBI:83403) |
| tipifarnib (CHEBI:141969) is a primary amino compound (CHEBI:50994) |
| tipifarnib (CHEBI:141969) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 6-[(R)-amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl]-4-(3-chlorophenyl)-1-methylquinolin-2(1H)-one |
| INNs | Source |
|---|---|
| tipifarnibum | WHO MedNet |
| tipifarnib | WHO MedNet |
| tipifarnib | WHO MedNet |
| tipifarnib | WHO MedNet |
| Synonyms | Source |
|---|---|
| (R)-6-(amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl)-4-(3-chlorophenyl)-1-methyl-2(1H)-quinolinone | ChemIDplus |
| R115777 | DrugBank |
| R-115777 | DrugBank |
| (+)-(R)-6-[amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl]-4-(3-chlorophenyl)-1-methyl-2(1H)-quinolinone | ChEBI |
| Brand Name | Source |
|---|---|
| Zarnestra | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB04960 | DrugBank |
| D03720 | KEGG DRUG |
| Tipifarnib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9734901 | Reaxys |
| CAS:192185-72-1 | ChemIDplus |
| Citations |
|---|