EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O5S2 |
| Net Charge | 0 |
| Average Mass | 438.571 |
| Monoisotopic Mass | 438.12831 |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1CC2(C[C@H]1C(=O)O)SCCS2 |
| InChI | InChI=1S/C20H26N2O5S2/c1-13(21-15(18(24)25)8-7-14-5-3-2-4-6-14)17(23)22-12-20(28-9-10-29-20)11-16(22)19(26)27/h2-6,13,15-16,21H,7-12H2,1H3,(H,24,25)(H,26,27)/t13-,15-,16-/m0/s1 |
| InChIKey | FMMDBLMCSDRUPA-BPUTZDHNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiraprilat (CHEBI:141522) has role antihypertensive agent (CHEBI:35674) |
| spiraprilat (CHEBI:141522) has role drug metabolite (CHEBI:49103) |
| spiraprilat (CHEBI:141522) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| spiraprilat (CHEBI:141522) is a azaspiro compound (CHEBI:35624) |
| spiraprilat (CHEBI:141522) is a dicarboxylic acid (CHEBI:35692) |
| spiraprilat (CHEBI:141522) is a dipeptide (CHEBI:46761) |
| spiraprilat (CHEBI:141522) is a dithioketal (CHEBI:59800) |
| spiraprilat (CHEBI:141522) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| spiraprilat (CHEBI:141522) is a secondary amino compound (CHEBI:50995) |
| spiraprilat (CHEBI:141522) is a tertiary carboxamide (CHEBI:140326) |
| Incoming Relation(s) |
| spirapril (CHEBI:135756) has functional parent spiraprilat (CHEBI:141522) |
| IUPAC Name |
|---|
| (8S)-7-[(2S)-2-{[(1S)-1-carboxy-3-phenylpropyl]amino}propanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| Synonyms | Source |
|---|---|
| 7-[N-(1(S)-carboxy-3-phenylpropyl)-S-alanyl]-1,4-dithia-7-azaspiro[4.4]nonane-8(S)-carboxylic acid | ChEBI |
| (8S)-7-((S)-N-((S)-1-Carboxy-3-phenylpropyl)alanyl)-1,4-dithia-7-azaspiro(4.4)nonane-8-carboxylic acid | ChemIDplus |
| SCH-33861 | SUBMITTER |
| Spiraprilate | ChemIDplus |
| Spiraprilatum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3033702 | PubChem Compound |
| D03775 | KEGG DRUG |
| Spiraprilat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4275869 | Reaxys |
| CAS:83602-05-5 | ChemIDplus |
| Citations |
|---|