EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O5S2 |
| Net Charge | 0 |
| Average Mass | 466.625 |
| Monoisotopic Mass | 466.15961 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1CC2(C[C@H]1C(=O)O)SCCS2 |
| InChI | InChI=1S/C22H30N2O5S2/c1-3-29-21(28)17(10-9-16-7-5-4-6-8-16)23-15(2)19(25)24-14-22(30-11-12-31-22)13-18(24)20(26)27/h4-8,15,17-18,23H,3,9-14H2,1-2H3,(H,26,27)/t15-,17-,18-/m0/s1 |
| InChIKey | HRWCVUIFMSZDJS-SZMVWBNQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirapril (CHEBI:135756) has functional parent spiraprilat (CHEBI:141522) |
| spirapril (CHEBI:135756) has role antihypertensive agent (CHEBI:35674) |
| spirapril (CHEBI:135756) has role cardiovascular drug (CHEBI:35554) |
| spirapril (CHEBI:135756) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| spirapril (CHEBI:135756) has role prodrug (CHEBI:50266) |
| spirapril (CHEBI:135756) is a azaspiro compound (CHEBI:35624) |
| spirapril (CHEBI:135756) is a dicarboxylic acid monoester (CHEBI:36244) |
| spirapril (CHEBI:135756) is a dipeptide (CHEBI:46761) |
| spirapril (CHEBI:135756) is a dithioketal (CHEBI:59800) |
| spirapril (CHEBI:135756) is a ethyl ester (CHEBI:23990) |
| spirapril (CHEBI:135756) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| spirapril (CHEBI:135756) is a secondary amino compound (CHEBI:50995) |
| spirapril (CHEBI:135756) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (8S)-7-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| INN | Source |
|---|---|
| espirapril | WHO MedNet |
| Synonym | Source |
|---|---|
| Spirapril | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2474 | DrugCentral |
| D08529 | KEGG DRUG |
| DB01348 | DrugBank |
| HMDB0015438 | HMDB |
| Spirapril | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4277924 | Reaxys |
| CAS:83647-97-6 | ChemIDplus |
| CAS:83647-97-6 | DrugCentral |
| Citations |
|---|