EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O5S2 |
| Net Charge | 0 |
| Average Mass | 466.625 |
| Monoisotopic Mass | 466.15961 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1CC2(C[C@H]1C(=O)O)SCCS2 |
| InChI | InChI=1S/C22H30N2O5S2/c1-3-29-21(28)17(10-9-16-7-5-4-6-8-16)23-15(2)19(25)24-14-22(30-11-12-31-22)13-18(24)20(26)27/h4-8,15,17-18,23H,3,9-14H2,1-2H3,(H,26,27)/t15-,17-,18-/m0/s1 |
| InChIKey | HRWCVUIFMSZDJS-SZMVWBNQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirapril (CHEBI:135756) has functional parent spiraprilat (CHEBI:141522) |
| spirapril (CHEBI:135756) has role antihypertensive agent (CHEBI:35674) |
| spirapril (CHEBI:135756) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| spirapril (CHEBI:135756) has role prodrug (CHEBI:50266) |
| spirapril (CHEBI:135756) is a azaspiro compound (CHEBI:35624) |
| spirapril (CHEBI:135756) is a dicarboxylic acid monoester (CHEBI:36244) |
| spirapril (CHEBI:135756) is a dipeptide (CHEBI:46761) |
| spirapril (CHEBI:135756) is a dithioketal (CHEBI:59800) |
| spirapril (CHEBI:135756) is a ethyl ester (CHEBI:23990) |
| spirapril (CHEBI:135756) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| spirapril (CHEBI:135756) is a secondary amino compound (CHEBI:50995) |
| spirapril (CHEBI:135756) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (8S)-7-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2474 | DrugCentral |
| D08529 | KEGG DRUG |
| DB01348 | DrugBank |
| HMDB0015438 | HMDB |
| Spirapril | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4277924 | Reaxys |
| CAS:83647-97-6 | ChemIDplus |
| CAS:83647-97-6 | DrugCentral |
| Citations |
|---|