EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N3O6 |
| Net Charge | 0 |
| Average Mass | 377.397 |
| Monoisotopic Mass | 377.15869 |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1C(=O)N(C)C[C@H]1C(=O)O |
| InChI | InChI=1S/C18H23N3O6/c1-11(15(22)21-14(17(25)26)10-20(2)18(21)27)19-13(16(23)24)9-8-12-6-4-3-5-7-12/h3-7,11,13-14,19H,8-10H2,1-2H3,(H,23,24)(H,25,26)/t11-,13-,14-/m0/s1 |
| InChIKey | VFAVNRVDTAPBNR-UBHSHLNASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imidaprilat (CHEBI:141520) has functional parent imidapril (CHEBI:135654) |
| imidaprilat (CHEBI:141520) has role antihypertensive agent (CHEBI:35674) |
| imidaprilat (CHEBI:141520) has role drug metabolite (CHEBI:49103) |
| imidaprilat (CHEBI:141520) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| imidaprilat (CHEBI:141520) is a N-acylurea (CHEBI:74266) |
| imidaprilat (CHEBI:141520) is a dicarboxylic acid (CHEBI:35692) |
| imidaprilat (CHEBI:141520) is a dipeptide (CHEBI:46761) |
| imidaprilat (CHEBI:141520) is a imidazolidines (CHEBI:38261) |
| imidaprilat (CHEBI:141520) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (4S)-3-{N-[(1S)-1-carboxy-3-phenylpropyl]-L-alanyl}-1-methyl-2-oxoimidazolidine-4-carboxylic acid |
| INNs | Source |
|---|---|
| imidaprilat | ChemIDplus |
| imidaprilatum | WHO MedNet |
| imidaprilate | WHO MedNet |
| imidaprilat | WHO MedNet |
| Synonym | Source |
|---|---|
| (4S)-1-methyl-3-{(2S)-2-[N-((1S)-1-carboxy-3-phenylpropyl)amino]propionyl}-2-oxo-imidazolidine-4-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C21519 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5857382 | Reaxys |
| CAS:89371-44-8 | ChemIDplus |
| Citations |
|---|