EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N3O6 |
| Net Charge | 0 |
| Average Mass | 405.451 |
| Monoisotopic Mass | 405.18999 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1C(=O)N(C)C[C@H]1C(=O)O |
| InChI | InChI=1S/C20H27N3O6/c1-4-29-19(27)15(11-10-14-8-6-5-7-9-14)21-13(2)17(24)23-16(18(25)26)12-22(3)20(23)28/h5-9,13,15-16,21H,4,10-12H2,1-3H3,(H,25,26)/t13-,15-,16-/m0/s1 |
| InChIKey | KLZWOWYOHUKJIG-BPUTZDHNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imidapril (CHEBI:135654) has role antihypertensive agent (CHEBI:35674) |
| imidapril (CHEBI:135654) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| imidapril (CHEBI:135654) has role prodrug (CHEBI:50266) |
| imidapril (CHEBI:135654) is a N-acylurea (CHEBI:74266) |
| imidapril (CHEBI:135654) is a dicarboxylic acid monoester (CHEBI:36244) |
| imidapril (CHEBI:135654) is a dipeptide (CHEBI:46761) |
| imidapril (CHEBI:135654) is a ethyl ester (CHEBI:23990) |
| imidapril (CHEBI:135654) is a imidazolidines (CHEBI:38261) |
| imidapril (CHEBI:135654) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| imidaprilat (CHEBI:141520) has functional parent imidapril (CHEBI:135654) |
| IUPAC Name |
|---|
| (4S)-3-{N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl}-1-methyl-2-oxoimidazolidine-4-carboxylic acid |
| INNs | Source |
|---|---|
| imidapril | WHO MedNet |
| imidapril | WHO MedNet |
| imidapril | ChemIDplus |
| imidaprilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (4S)-1-methyl-3-[(2S)-2-[N-((1S)-1-ethoxycarbonyl-3-phenylpropyl)amino]propionyl]-2-oxo-imidazolidine-4-carboxylic acid | ChEBI |
| (S)-3-(N-((S)-1-Ethoxycarbonyl-3-phenylpropyl)-L-alanyl)-1-methyl-2-oxoimidazoline-4-carboxylic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| tanatril | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4847938 | Reaxys |
| CAS:89371-37-9 | ChemIDplus |
| CAS:89371-37-9 | DrugCentral |
| Citations |
|---|