EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N3O6 |
| Net Charge | 0 |
| Average Mass | 405.451 |
| Monoisotopic Mass | 405.18999 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1C(=O)N(C)C[C@H]1C(=O)O |
| InChI | InChI=1S/C20H27N3O6/c1-4-29-19(27)15(11-10-14-8-6-5-7-9-14)21-13(2)17(24)23-16(18(25)26)12-22(3)20(23)28/h5-9,13,15-16,21H,4,10-12H2,1-3H3,(H,25,26)/t13-,15-,16-/m0/s1 |
| InChIKey | KLZWOWYOHUKJIG-BPUTZDHNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imidapril (CHEBI:135654) has role antihypertensive agent (CHEBI:35674) |
| imidapril (CHEBI:135654) has role cardiovascular drug (CHEBI:35554) |
| imidapril (CHEBI:135654) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| imidapril (CHEBI:135654) has role prodrug (CHEBI:50266) |
| imidapril (CHEBI:135654) is a N-acylurea (CHEBI:74266) |
| imidapril (CHEBI:135654) is a dicarboxylic acid monoester (CHEBI:36244) |
| imidapril (CHEBI:135654) is a dipeptide (CHEBI:46761) |
| imidapril (CHEBI:135654) is a ethyl ester (CHEBI:23990) |
| imidapril (CHEBI:135654) is a imidazolidines (CHEBI:38261) |
| imidapril (CHEBI:135654) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| imidaprilat (CHEBI:141520) has functional parent imidapril (CHEBI:135654) |
| IUPAC Name |
|---|
| (4S)-3-{N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl}-1-methyl-2-oxoimidazolidine-4-carboxylic acid |
| INNs | Source |
|---|---|
| imidapril | WHO MedNet |
| imidapril | WHO MedNet |
| imidapril | ChemIDplus |
| imidaprilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (4S)-1-methyl-3-[(2S)-2-[N-((1S)-1-ethoxycarbonyl-3-phenylpropyl)amino]propionyl]-2-oxo-imidazolidine-4-carboxylic acid | ChEBI |
| Hipertene | ChEMBL |
| Imidapril hcl | ChEMBL |
| Imidapril monohydrochloride | ChEMBL |
| (S)-3-(N-((S)-1-Ethoxycarbonyl-3-phenylpropyl)-L-alanyl)-1-methyl-2-oxoimidazoline-4-carboxylic acid | ChemIDplus |
| TA 6366 | ChEMBL |
| Brand Name | Source |
|---|---|
| tanatril | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4847938 | Reaxys |
| CAS:89371-37-9 | DrugCentral |
| CAS:89371-37-9 | ChemIDplus |
| Citations |
|---|