EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28F3N3O3 |
| Net Charge | 0 |
| Average Mass | 463.500 |
| Monoisotopic Mass | 463.20828 |
| SMILES | COc1cc(C)c2c(Oc3cccc(C(F)(F)F)c3)c(OC)cc(N[C@H](C)CCCN)c2n1 |
| InChI | InChI=1S/C24H28F3N3O3/c1-14-11-20(32-4)30-22-18(29-15(2)7-6-10-28)13-19(31-3)23(21(14)22)33-17-9-5-8-16(12-17)24(25,26)27/h5,8-9,11-13,15,29H,6-7,10,28H2,1-4H3/t15-/m1/s1 |
| InChIKey | LBHLFPGPEGDCJG-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-tafenoquine (CHEBI:141488) is a N4-{2,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-yl}pentane-1,4-diamine (CHEBI:141487) |
| (R)-tafenoquine (CHEBI:141488) is enantiomer of (S)-tafenoquine (CHEBI:141489) |
| Incoming Relation(s) |
| tafenoquine (CHEBI:135752) has part (R)-tafenoquine (CHEBI:141488) |
| (S)-tafenoquine (CHEBI:141489) is enantiomer of (R)-tafenoquine (CHEBI:141488) |