EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO3 |
| Net Charge | 0 |
| Average Mass | 301.386 |
| Monoisotopic Mass | 301.16779 |
| SMILES | CO[C@H]1CC[C@]2(CC1)NC(=O)C(c1cc(C)ccc1C)=C2O |
| InChI | InChI=1S/C18H23NO3/c1-11-4-5-12(2)14(10-11)15-16(20)18(19-17(15)21)8-6-13(22-3)7-9-18/h4-5,10,13,20H,6-9H2,1-3H3,(H,19,21)/t13-,18+ |
| InChIKey | IDJJHEIUIYGFDX-QGGXVJLZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) has role agrochemical (CHEBI:33286) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) has role insecticide (CHEBI:24852) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) is a azaspiro compound (CHEBI:35624) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) is a benzenes (CHEBI:22712) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) is a enol (CHEBI:33823) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) is a ether (CHEBI:25698) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) is a organic hydroxy compound (CHEBI:33822) |
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (CHEBI:141400) is a tetramic acids (CHEBI:140155) |
| IUPAC Name |
|---|
| (5s,8s)-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one |
| Synonyms | Source |
|---|---|
| cis-3-(2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro(4.5)dec-3-en-2-one | ChemIDplus |
| spirotetramat-enol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2010324303 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19128308 | Reaxys |
| CAS:203312-38-3 | ChemIDplus |
| Citations |
|---|