EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | CN(CC(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c1-11(7-9(12)13)10(14)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,12,13) |
| InChIKey | PKCSYDDSNIJRIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylhippuric acid (CHEBI:141362) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| N-methylhippuric acid (CHEBI:141362) is a N-acylglycine (CHEBI:16180) |
| N-methylhippuric acid (CHEBI:141362) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| N-benzoyl-N-methylglycine |
| Synonyms | Source |
|---|---|
| 2-(N-methyl-1-phenylformamido)acetic acid | ChEBI |
| [benzoyl(methyl)amino]acetic acid | ChEBI |
| [N-benzoyl-N-methylamino]acetic acid | ChEBI |
| N-benzoyl-N-methylglycine | ChemIDplus |
| N-benzoylsarcosine | ChemIDplus |
| (N-methyl-1-phenylformamido)acetic acid | ChEBI |
| Citations |
|---|