EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O3 |
| Net Charge | 0 |
| Average Mass | 316.401 |
| Monoisotopic Mass | 316.17869 |
| SMILES | CCc1cc(C)cc(CC)c1-c1c(O)n2n(c1=O)CCOCC2 |
| InChI | InChI=1S/C18H24N2O3/c1-4-13-10-12(3)11-14(5-2)15(13)16-17(21)19-6-8-23-9-7-20(19)18(16)22/h10-11,21H,4-9H2,1-3H3 |
| InChIKey | YWZBGRYDSPLRHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinoxaden acid (CHEBI:141347) has role agrochemical (CHEBI:33286) |
| pinoxaden acid (CHEBI:141347) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| pinoxaden acid (CHEBI:141347) has role environmental contaminant (CHEBI:78298) |
| pinoxaden acid (CHEBI:141347) has role herbicide (CHEBI:24527) |
| pinoxaden acid (CHEBI:141347) has role xenobiotic (CHEBI:35703) |
| pinoxaden acid (CHEBI:141347) is a benzenes (CHEBI:22712) |
| pinoxaden acid (CHEBI:141347) is a organic hydroxy compound (CHEBI:33822) |
| pinoxaden acid (CHEBI:141347) is a pyrazolooxadiazepine (CHEBI:136684) |
| Incoming Relation(s) |
| pinoxaden (CHEBI:83524) has functional parent pinoxaden acid (CHEBI:141347) |
| IUPAC Name |
|---|
| 8-(2,6-diethyl-4-methylphenyl)-9-hydroxy-1,2,4,5-tetrahydro-7H-pyrazolo[1,2-d][1,4,5]oxadiazepin-7-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31687354 | Reaxys |