EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O4 |
| Net Charge | 0 |
| Average Mass | 276.332 |
| Monoisotopic Mass | 276.13616 |
| SMILES | [H]C(CCC)=C([H])C([H])=C([H])C([H])=C([H])CCc1ccc(OC(=O)O)o1 |
| InChI | InChI=1S/C16H20O4/c1-2-3-4-5-6-7-8-9-10-11-14-12-13-15(19-14)20-16(17)18/h4-9,12-13H,2-3,10-11H2,1H3,(H,17,18) |
| InChIKey | SAGFYRGTZFFXNC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (28927292) | Species also known as Emericella sp. Strain: XL029 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) has functional parent 5-(undeca-3,5,7-trien-1-yl)furan-2-ol (CHEBI:141341) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) has role antifungal agent (CHEBI:35718) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) has role fungal metabolite (CHEBI:76946) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) is a carbonate ester (CHEBI:46722) |
| IUPAC Name |
|---|
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate |
| Synonym | Source |
|---|---|
| 5-(undeca-3,5,7-trien-1-yl)furan-2-ol-carbonate | ChEBI |
| Citations |
|---|