EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O4 |
| Net Charge | 0 |
| Average Mass | 276.332 |
| Monoisotopic Mass | 276.13616 |
| SMILES | [H]C(CCC)=C([H])C([H])=C([H])C([H])=C([H])CCc1ccc(OC(=O)O)o1 |
| InChI | InChI=1S/C16H20O4/c1-2-3-4-5-6-7-8-9-10-11-14-12-13-15(19-14)20-16(17)18/h4-9,12-13H,2-3,10-11H2,1H3,(H,17,18) |
| InChIKey | SAGFYRGTZFFXNC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (28927292) | Species also known as Emericella sp. Strain: XL029 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) has functional parent 5-(undeca-3,5,7-trien-1-yl)furan-2-ol (CHEBI:141341) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) has role antifungal agent (CHEBI:35718) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) has role fungal metabolite (CHEBI:76946) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) is a carbonate ester (CHEBI:46722) |
| IUPAC Name |
|---|
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate |
| Synonym | Source |
|---|---|
| 5-(undeca-3,5,7-trien-1-yl)furan-2-ol-carbonate | ChEBI |
| Citations |
|---|