EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | [H]C(CCC)=C([H])C([H])=C([H])C([H])=C([H])CCc1ccc(O)o1 |
| InChI | InChI=1S/C15H20O2/c1-2-3-4-5-6-7-8-9-10-11-14-12-13-15(16)17-14/h4-9,12-13,16H,2-3,10-11H2,1H3 |
| InChIKey | VNMQLLMDZZVYRC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(undeca-3,5,7-trien-1-yl)furan-2-ol (CHEBI:141341) has role antifungal agent (CHEBI:35718) |
| 5-(undeca-3,5,7-trien-1-yl)furan-2-ol (CHEBI:141341) has role fungal metabolite (CHEBI:76946) |
| 5-(undeca-3,5,7-trien-1-yl)furan-2-ol (CHEBI:141341) is a furans (CHEBI:24129) |
| Incoming Relation(s) |
| 5-(undeca-3,5,7-trien-1-yl)-2-furyl hydrogen carbonate (CHEBI:141342) has functional parent 5-(undeca-3,5,7-trien-1-yl)furan-2-ol (CHEBI:141341) |
| IUPAC Name |
|---|
| 5-(undeca-3,5,7-trien-1-yl)furan-2-ol |
| Citations |
|---|