EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24ClNO8 |
| Net Charge | 0 |
| Average Mass | 489.908 |
| Monoisotopic Mass | 489.11904 |
| SMILES | O=C(O)CCCCC1Cc2c(Cl)cc(C(=O)N[C@@H](Cc3ccccc3)C(=O)O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C24H24ClNO8/c25-17-12-16(22(30)26-18(23(31)32)10-13-6-2-1-3-7-13)21(29)20-15(17)11-14(34-24(20)33)8-4-5-9-19(27)28/h1-3,6-7,12,14,18,29H,4-5,8-11H2,(H,26,30)(H,27,28)(H,31,32)/t14?,18-/m0/s1 |
| InChIKey | FTWYAEHEAFBKQR-IBYPIGCZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hapten OTAd (CHEBI:141313) has functional parent ochratoxin A (CHEBI:7719) |
| hapten OTAd (CHEBI:141313) has role hapten (CHEBI:59174) |
| hapten OTAd (CHEBI:141313) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| hapten OTAd (CHEBI:141313) is a diastereoisomeric mixture (CHEBI:60915) |
| hapten OTAd (CHEBI:141313) is a isochromanes (CHEBI:38762) |
| hapten OTAd (CHEBI:141313) is a monocarboxylic acid amide (CHEBI:29347) |
| hapten OTAd (CHEBI:141313) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 5-(7-{[(1S)-1-carboxy-2-phenylethyl]carbamoyl}-5-chloro-8-hydroxy-1-oxo-3,4-dihydro-1H-2-benzopyran-3-yl)pentanoic acid |
| Synonyms | Source |
|---|---|
| N-[[3-(4-carboxybutyl)-5-chloro-3,4-dihydro-8-hydroxy-1-oxo-1H-2-benzopyran-7-yl]carbonyl]-L-phenylalanine | IUPAC |
| 5-(7-{[(1S)-1-carboxy-2-phenylethyl]carbamoyl}-5-chloro-8-hydroxy-1-oxo-3,4-dihydro-1H-isochromen-3-yl)pentanoic acid | IUPAC |
| Citations |
|---|