EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28ClNO8 |
| Net Charge | 0 |
| Average Mass | 517.962 |
| Monoisotopic Mass | 517.15034 |
| SMILES | CC1Cc2c(Cl)cc(C(=O)N[C@@H](Cc3ccc(CCCCCC(=O)O)cc3)C(=O)O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C26H28ClNO8/c1-14-11-17-19(27)13-18(23(31)22(17)26(35)36-14)24(32)28-20(25(33)34)12-16-9-7-15(8-10-16)5-3-2-4-6-21(29)30/h7-10,13-14,20,31H,2-6,11-12H2,1H3,(H,28,32)(H,29,30)(H,33,34)/t14?,20-/m0/s1 |
| InChIKey | JQANLPZXPZFWFL-LGTGAQBVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hapten OTAb (CHEBI:141300) has functional parent ochratoxin A (CHEBI:7719) |
| hapten OTAb (CHEBI:141300) has role hapten (CHEBI:59174) |
| hapten OTAb (CHEBI:141300) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| hapten OTAb (CHEBI:141300) is a diastereoisomeric mixture (CHEBI:60915) |
| hapten OTAb (CHEBI:141300) is a isochromanes (CHEBI:38762) |
| hapten OTAb (CHEBI:141300) is a monocarboxylic acid amide (CHEBI:29347) |
| hapten OTAb (CHEBI:141300) is a organochlorine compound (CHEBI:36683) |
| hapten OTAb (CHEBI:141300) is a phenylalanine derivative (CHEBI:25985) |
| IUPAC Name |
|---|
| 6-(4-{(2S)-2-carboxy-2-[(5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carbonyl)amino]ethyl}phenyl)hexanoic acid |
| Synonyms | Source |
|---|---|
| 4-(5-carboxypentyl)-N-[(5-chloro-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl)carbonyl]-L-phenylalanine | ChEBI |
| 6-{4-[(2S)-2-carboxy-2-{[(5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-isochromen-7-yl)carbonyl]amino}ethyl]phenyl}hexanoic acid | IUPAC |
| Citations |
|---|